C14H15N3O4S — CID 155540310
2-[[1-(2-ethoxy-2-oxoethyl)triazol-4-yl]methylsulfanyl]benzoic acid (PubChem CID 155540310) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-[[1-(2-ethoxy-2-oxoethyl)triazol-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[1-(2-ethoxy-2-oxoethyl)triazol-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 155540310 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-[[1-(2-ethoxy-2-oxoethyl)triazol-4-yl]methylsulfanyl]benzoic acid |
| SMILES | CCOC(=O)Cn1cc(CSc2ccccc2C(=O)O)nn1 |
| InChI | InChI=1S/C14H15N3O4S/c1-2-21-13(18)8-17-7-10(15-16-17)9-22-12-6-4-3-5-11(12)14(19)20/h3-7H,2,8-9H2,1H3,(H,19,20) |
| InChIKey | CSBHTOOXAPWXPV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |