C25H33N3O2S — CID 155566415
2-[[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]methylsulfanyl]benzoic acid (PubChem CID 155566415) has the molecular formula C25H33N3O2S and a molecular weight of 439.63 g/mol. Its IUPAC name is 2-[[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 155566415 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 2-[[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]methylsulfanyl]benzoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/Cn1cc(CSc2ccccc2C(=O)O)nn1 |
| InChI | InChI=1S/C25H33N3O2S/c1-19(2)9-7-10-20(3)11-8-12-21(4)15-16-28-17-22(26-27-28)18-31-24-14-6-5-13-23(24)25(29)30/h5-6,9,11,13-15,17H,7-8,10,12,16,18H2,1-4H3,(H,29,30)/b20-11+,21-15+ |
| InChIKey | KPMLBEDRXIGATE-JAGDBARYSA-N |
| XLogP | 6.69 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|