C19H33N3O6P2 — CID 71521672
[1-phosphono-2-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]ethyl]phosphonic acid (PubChem CID 71521672) has the molecular formula C19H33N3O6P2 and a molecular weight of 461.44 g/mol. Its IUPAC name is [1-phosphono-2-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]ethyl]phosphonic acid.
| Compound Name | [1-phosphono-2-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 71521672 |
| Molecular Formula | C19H33N3O6P2 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [1-phosphono-2-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]ethyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/Cn1cc(CC(P(=O)(O)O)P(=O)(O)O)nn1 |
| InChI | InChI=1S/C19H33N3O6P2/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-22-14-18(20-21-22)13-19(29(23,24)25)30(26,27)28/h7,9,11,14,19H,5-6,8,10,12-13H2,1-4H3,(H2,23,24,25)(H2,26,27,28)/b16-9+,17-11+ |
| InChIKey | TYZUTYHCEMHWEJ-BTMZFSHUSA-N |
| XLogP | 3.92 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|