C16H28N3P — CID 142463331
[1-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-2-methylpropan-2-yl]phosphane (PubChem CID 142463331) has the molecular formula C16H28N3P and a molecular weight of 293.40 g/mol. Its IUPAC name is [1-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-2-methylpropan-2-yl]phosphane.
| Compound Name | [1-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-2-methylpropan-2-yl]phosphane |
|---|---|
| PubChem CID | 142463331 |
| Molecular Formula | C16H28N3P |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [1-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-2-methylpropan-2-yl]phosphane |
| SMILES | CC(C)=CCC/C(C)=C/Cn1cc(CC(C)(C)P)nn1 |
| InChI | InChI=1S/C16H28N3P/c1-13(2)7-6-8-14(3)9-10-19-12-15(17-18-19)11-16(4,5)20/h7,9,12H,6,8,10-11,20H2,1-5H3/b14-9+ |
| InChIKey | ZKDVLLMTFBKITR-NTEUORMPSA-N |
| XLogP | 4.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|