C15H23N3O7P2-4 — CID 172638126
2-[4-[(3Z)-4,8-dimethylnona-3,7-dienyl]triazol-1-yl]-1,1-diphosphonatoethanol (PubChem CID 172638126) has the molecular formula C15H23N3O7P2-4 and a molecular weight of 419.31 g/mol. Its IUPAC name is 2-[4-[(3Z)-4,8-dimethylnona-3,7-dienyl]triazol-1-yl]-1,1-diphosphonatoethanol.
| Compound Name | 2-[4-[(3Z)-4,8-dimethylnona-3,7-dienyl]triazol-1-yl]-1,1-diphosphonatoethanol |
|---|---|
| PubChem CID | 172638126 |
| Molecular Formula | C15H23N3O7P2-4 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-[4-[(3Z)-4,8-dimethylnona-3,7-dienyl]triazol-1-yl]-1,1-diphosphonatoethanol |
| SMILES | CC(C)=CCC/C(C)=C\CCc1cn(CC(O)(P(=O)([O-])[O-])P(=O)([O-])[O-])nn1 |
| InChI | InChI=1S/C15H27N3O7P2/c1-12(2)6-4-7-13(3)8-5-9-14-10-18(17-16-14)11-15(19,26(20,21)22)27(23,24)25/h6,8,10,19H,4-5,7,9,11H2,1-3H3,(H2,20,21,22)(H2,23,24,25)/p-4/b13-8- |
| InChIKey | VFUHOXBQGVLVPL-JYRVWZFOSA-J |
| XLogP | -0.62 |
| TPSA | 177.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|