C24H33N3O — CID 25258924
4-(2-methoxyphenyl)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazole (PubChem CID 25258924) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazole.
| Compound Name | 4-(2-methoxyphenyl)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazole |
|---|---|
| PubChem CID | 25258924 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 4-(2-methoxyphenyl)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazole |
| SMILES | COc1ccccc1-c1cn(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)nn1 |
| InChI | InChI=1S/C24H33N3O/c1-19(2)10-8-11-20(3)12-9-13-21(4)16-17-27-18-23(25-26-27)22-14-6-7-15-24(22)28-5/h6-7,10,12,14-16,18H,8-9,11,13,17H2,1-5H3/b20-12+,21-16+ |
| InChIKey | PNMPIWHABOZGAU-FJNYLYSMSA-N |
| XLogP | 6.37 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|