C15H23N3O6P2-4 — CID 172637931
[1-[1-[(2Z)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-2-phosphonatopropan-2-yl]-dioxido-oxo-λ5-phosphane (PubChem CID 172637931) has the molecular formula C15H23N3O6P2-4 and a molecular weight of 403.31 g/mol. Its IUPAC name is [1-[1-[(2Z)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-2-phosphonatopropan-2-yl]-dioxido-oxo-λ5-phosphane.
| Compound Name | [1-[1-[(2Z)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-2-phosphonatopropan-2-yl]-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 172637931 |
| Molecular Formula | C15H23N3O6P2-4 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [1-[1-[(2Z)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-2-phosphonatopropan-2-yl]-dioxido-oxo-λ5-phosphane |
| SMILES | CC(C)=CCC/C(C)=C\Cn1cc(CC(C)(P(=O)([O-])[O-])P(=O)([O-])[O-])nn1 |
| InChI | InChI=1S/C15H27N3O6P2/c1-12(2)6-5-7-13(3)8-9-18-11-14(16-17-18)10-15(4,25(19,20)21)26(22,23)24/h6,8,11H,5,7,9-10H2,1-4H3,(H2,19,20,21)(H2,22,23,24)/p-4/b13-8- |
| InChIKey | GYDWCQXCCIWZQO-JYRVWZFOSA-J |
| XLogP | 0.06 |
| TPSA | 157.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|