C14H23N3O6P2 — CID 164613574
[2-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-1-phosphonoethenyl]phosphonic acid (PubChem CID 164613574) has the molecular formula C14H23N3O6P2 and a molecular weight of 391.30 g/mol. Its IUPAC name is [2-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-1-phosphonoethenyl]phosphonic acid.
| Compound Name | [2-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-1-phosphonoethenyl]phosphonic acid |
|---|---|
| PubChem CID | 164613574 |
| Molecular Formula | C14H23N3O6P2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [2-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]-1-phosphonoethenyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/Cn1cc(C=C(P(=O)(O)O)P(=O)(O)O)nn1 |
| InChI | InChI=1S/C14H23N3O6P2/c1-11(2)5-4-6-12(3)7-8-17-10-13(15-16-17)9-14(24(18,19)20)25(21,22)23/h5,7,9-10H,4,6,8H2,1-3H3,(H2,18,19,20)(H2,21,22,23)/b12-7+ |
| InChIKey | GQYCFKONCDOBKA-KPKJPENVSA-N |
| XLogP | 2.62 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|