C23H43N3O6P2 — CID 132581468
4-[2,2-bis(diethoxyphosphoryl)ethyl]-1-[(3E)-4,8-dimethylnona-3,7-dienyl]triazole (PubChem CID 132581468) has the molecular formula C23H43N3O6P2 and a molecular weight of 519.56 g/mol. Its IUPAC name is 4-[2,2-bis(diethoxyphosphoryl)ethyl]-1-[(3E)-4,8-dimethylnona-3,7-dienyl]triazole.
| Compound Name | 4-[2,2-bis(diethoxyphosphoryl)ethyl]-1-[(3E)-4,8-dimethylnona-3,7-dienyl]triazole |
|---|---|
| PubChem CID | 132581468 |
| Molecular Formula | C23H43N3O6P2 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 4-[2,2-bis(diethoxyphosphoryl)ethyl]-1-[(3E)-4,8-dimethylnona-3,7-dienyl]triazole |
| SMILES | CCOP(=O)(OCC)C(Cc1cn(CC/C=C(\C)CCC=C(C)C)nn1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C23H43N3O6P2/c1-8-29-33(27,30-9-2)23(34(28,31-10-3)32-11-4)18-22-19-26(25-24-22)17-13-16-21(7)15-12-14-20(5)6/h14,16,19,23H,8-13,15,17-18H2,1-7H3/b21-16+ |
| InChIKey | UHRFLMOCATUMOM-LTGZKZEYSA-N |
| XLogP | 6.76 |
| TPSA | 101.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|