C15H29O3P — CID 11335218
(6E)-9-diethoxyphosphoryl-2,6-dimethylnona-2,6-diene (PubChem CID 11335218) has the molecular formula C15H29O3P and a molecular weight of 288.37 g/mol. Its IUPAC name is (6E)-9-diethoxyphosphoryl-2,6-dimethylnona-2,6-diene.
| Compound Name | (6E)-9-diethoxyphosphoryl-2,6-dimethylnona-2,6-diene |
|---|---|
| PubChem CID | 11335218 |
| Molecular Formula | C15H29O3P |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (6E)-9-diethoxyphosphoryl-2,6-dimethylnona-2,6-diene |
| SMILES | CCOP(=O)(CC/C=C(\C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C15H29O3P/c1-6-17-19(16,18-7-2)13-9-12-15(5)11-8-10-14(3)4/h10,12H,6-9,11,13H2,1-5H3/b15-12+ |
| InChIKey | PVWKKGGOPYHALN-NTCAYCPXSA-N |
| XLogP | 5.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|