C26H46NO6P — CID 10458623
ethyl 2-(diethoxyphosphorylmethyl)-3-oxo-3-[[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]amino]propanoate (PubChem CID 10458623) has the molecular formula C26H46NO6P and a molecular weight of 499.63 g/mol. Its IUPAC name is ethyl 2-(diethoxyphosphorylmethyl)-3-oxo-3-[[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]amino]propanoate.
| Compound Name | ethyl 2-(diethoxyphosphorylmethyl)-3-oxo-3-[[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]amino]propanoate |
|---|---|
| PubChem CID | 10458623 |
| Molecular Formula | C26H46NO6P |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | ethyl 2-(diethoxyphosphorylmethyl)-3-oxo-3-[[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]amino]propanoate |
| SMILES | CCOC(=O)C(CP(=O)(OCC)OCC)C(=O)NCC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H46NO6P/c1-8-31-26(29)24(20-34(30,32-9-2)33-10-3)25(28)27-19-13-18-23(7)17-12-16-22(6)15-11-14-21(4)5/h14,16,18,24H,8-13,15,17,19-20H2,1-7H3,(H,27,28)/b22-16+,23-18+ |
| InChIKey | JJMWBLMPXCAQPQ-NERIYXGDSA-N |
| XLogP | 6.36 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|