C26H46NO6P — CID 10345855
ethyl 2-(diethoxyphosphorylmethyl)-3-[methyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]-3-oxopropanoate (PubChem CID 10345855) has the molecular formula C26H46NO6P and a molecular weight of 499.63 g/mol. Its IUPAC name is ethyl 2-(diethoxyphosphorylmethyl)-3-[methyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]-3-oxopropanoate.
| Compound Name | ethyl 2-(diethoxyphosphorylmethyl)-3-[methyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10345855 |
| Molecular Formula | C26H46NO6P |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | ethyl 2-(diethoxyphosphorylmethyl)-3-[methyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(CP(=O)(OCC)OCC)C(=O)N(C)C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H46NO6P/c1-9-31-26(29)24(20-34(30,32-10-2)33-11-3)25(28)27(8)19-18-23(7)17-13-16-22(6)15-12-14-21(4)5/h14,16,18,24H,9-13,15,17,19-20H2,1-8H3/b22-16+,23-18+ |
| InChIKey | URDDZDFSZDUGAA-NERIYXGDSA-N |
| XLogP | 6.31 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|