C24H42O5P2-2 — CID 21197638
[ethoxy-[(3E,7E,11E)-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]phosphoryl]methyl-dioxido-oxo-λ5-phosphane (PubChem CID 21197638) has the molecular formula C24H42O5P2-2 and a molecular weight of 472.54 g/mol. Its IUPAC name is [ethoxy-[(3E,7E,11E)-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]phosphoryl]methyl-dioxido-oxo-λ5-phosphane.
| Compound Name | [ethoxy-[(3E,7E,11E)-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]phosphoryl]methyl-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 21197638 |
| Molecular Formula | C24H42O5P2-2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [ethoxy-[(3E,7E,11E)-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]phosphoryl]methyl-dioxido-oxo-λ5-phosphane |
| SMILES | CCOP(=O)(CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CP(=O)([O-])[O-] |
| InChI | InChI=1S/C24H44O5P2/c1-7-29-30(25,20-31(26,27)28)19-11-18-24(6)17-10-16-23(5)15-9-14-22(4)13-8-12-21(2)3/h12,14,16,18H,7-11,13,15,17,19-20H2,1-6H3,(H2,26,27,28)/p-2/b22-14+,23-16+,24-18+ |
| InChIKey | WGUVLCGBCJHFMO-FNUUCIPGSA-L |
| XLogP | 6.71 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|