C10H17Li2O4P — CID 155290577
dilithium;[(2E)-3,7-dimethylocta-2,6-dienyl] phosphate (PubChem CID 155290577) has the molecular formula C10H17Li2O4P and a molecular weight of 246.10 g/mol. Its IUPAC name is dilithium;[(2E)-3,7-dimethylocta-2,6-dienyl] phosphate.
| Compound Name | dilithium;[(2E)-3,7-dimethylocta-2,6-dienyl] phosphate |
|---|---|
| PubChem CID | 155290577 |
| Molecular Formula | C10H17Li2O4P |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | dilithium;[(2E)-3,7-dimethylocta-2,6-dienyl] phosphate |
| SMILES | CC(C)=CCC/C(C)=C/COP(=O)([O-])[O-].[Li+].[Li+] |
| InChI | InChI=1S/C10H19O4P.2Li/c1-9(2)5-4-6-10(3)7-8-14-15(11,12)13;;/h5,7H,4,6,8H2,1-3H3,(H2,11,12,13);;/q;2*+1/p-2/b10-7+;; |
| InChIKey | LEPMLCHRGMSDTM-WRQJSNHTSA-L |
| XLogP | -4.47 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|