C25H46O8P2 — CID 174760400
[(2E)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate;3,7,11-trimethyldodeca-2,6,10-trienyl dihydrogen phosphate (PubChem CID 174760400) has the molecular formula C25H46O8P2 and a molecular weight of 536.58 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate;3,7,11-trimethyldodeca-2,6,10-trienyl dihydrogen phosphate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate;3,7,11-trimethyldodeca-2,6,10-trienyl dihydrogen phosphate |
|---|---|
| PubChem CID | 174760400 |
| Molecular Formula | C25H46O8P2 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate;3,7,11-trimethyldodeca-2,6,10-trienyl dihydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C/COP(=O)(O)O.CC(C)=CCCC(C)=CCCC(C)=CCOP(=O)(O)O |
| InChI | InChI=1S/C15H27O4P.C10H19O4P/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-19-20(16,17)18;1-9(2)5-4-6-10(3)7-8-14-15(11,12)13/h7,9,11H,5-6,8,10,12H2,1-4H3,(H2,16,17,18);5,7H,4,6,8H2,1-3H3,(H2,11,12,13)/b;10-7+ |
| InChIKey | STEUVUOMLDTGBK-FXRCEOBJSA-N |
| XLogP | 7.30 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|