C60H99O4P — CID 122511254
tris[(2Z,6Z,10Z)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] phosphate (PubChem CID 122511254) has the molecular formula C60H99O4P and a molecular weight of 915.42 g/mol. Its IUPAC name is tris[(2Z,6Z,10Z)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] phosphate.
| Compound Name | tris[(2Z,6Z,10Z)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] phosphate |
|---|---|
| PubChem CID | 122511254 |
| Molecular Formula | C60H99O4P |
| Molecular Weight | 915.42 g/mol |
| Exact Mass | 914.73 |
| IUPAC Name | tris[(2Z,6Z,10Z)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] phosphate |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\CC/C(C)=C\COP(=O)(OC/C=C(/C)CC/C=C(/C)CC/C=C(/C)CCC=C(C)C)OC/C=C(/C)CC/C=C(/C)CC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C60H99O4P/c1-49(2)25-16-28-52(7)31-19-34-55(10)37-22-40-58(13)43-46-62-65(61,63-47-44-59(14)41-23-38-56(11)35-20-32-53(8)29-17-26-50(3)4)64-48-45-60(15)42-24-39-57(12)36-21-33-54(9)30-18-27-51(5)6/h25-27,31-33,37-39,43-45H,16-24,28-30,34-36,40-42,46-48H2,1-15H3/b52-31-,53-32-,54-33-,55-37-,56-38-,57-39-,58-43-,59-44-,60-45- |
| InChIKey | DQJOCZJGYOJSBH-KKUXIMHGSA-N |
| XLogP | 20.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.42 |
| LogP ≤ 5 | 20.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|