C15H25Na2O4P — CID 11791843
disodium;[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] phosphate (PubChem CID 11791843) has the molecular formula C15H25Na2O4P and a molecular weight of 346.32 g/mol. Its IUPAC name is disodium;[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] phosphate.
| Compound Name | disodium;[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] phosphate |
|---|---|
| PubChem CID | 11791843 |
| Molecular Formula | C15H25Na2O4P |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | disodium;[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] phosphate |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\COP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C15H27O4P.2Na/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-19-20(16,17)18;;/h7,9,11H,5-6,8,10,12H2,1-4H3,(H2,16,17,18);;/q;2*+1/p-2/b14-9-,15-11-;; |
| InChIKey | WDEMLXHWOYWXDZ-XPYRFINYSA-L |
| XLogP | -2.74 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|