C10H22O8P2 — CID 174363137
[(2E)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate;phosphoric acid (PubChem CID 174363137) has the molecular formula C10H22O8P2 and a molecular weight of 332.23 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate;phosphoric acid.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate;phosphoric acid |
|---|---|
| PubChem CID | 174363137 |
| Molecular Formula | C10H22O8P2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate;phosphoric acid |
| SMILES | CC(C)=CCC/C(C)=C/COP(=O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C10H19O4P.H3O4P/c1-9(2)5-4-6-10(3)7-8-14-15(11,12)13;1-5(2,3)4/h5,7H,4,6,8H2,1-3H3,(H2,11,12,13);(H3,1,2,3,4)/b10-7+; |
| InChIKey | RGISYXVFXSKFHN-HCUGZAAXSA-N |
| XLogP | 1.86 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|