C10H20O8P2 — CID 135057363
[(2E)-3,7-dimethylocta-2,6-dienyl] phosphonooxy hydrogen phosphate (PubChem CID 135057363) has the molecular formula C10H20O8P2 and a molecular weight of 330.21 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] phosphonooxy hydrogen phosphate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] phosphonooxy hydrogen phosphate |
|---|---|
| PubChem CID | 135057363 |
| Molecular Formula | C10H20O8P2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] phosphonooxy hydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C/COP(=O)(O)OOP(=O)(O)O |
| InChI | InChI=1S/C10H20O8P2/c1-9(2)5-4-6-10(3)7-8-16-20(14,15)18-17-19(11,12)13/h5,7H,4,6,8H2,1-3H3,(H,14,15)(H2,11,12,13)/b10-7+ |
| InChIKey | FZXQGEVMWSUAII-JXMROGBWSA-N |
| XLogP | 2.84 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|