C16H29O4P — CID 161243603
3,7,11-trimethyltrideca-2,6,10-trienyl dihydrogen phosphate (PubChem CID 161243603) has the molecular formula C16H29O4P and a molecular weight of 316.38 g/mol. Its IUPAC name is 3,7,11-trimethyltrideca-2,6,10-trienyl dihydrogen phosphate.
| Compound Name | 3,7,11-trimethyltrideca-2,6,10-trienyl dihydrogen phosphate |
|---|---|
| PubChem CID | 161243603 |
| Molecular Formula | C16H29O4P |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 3,7,11-trimethyltrideca-2,6,10-trienyl dihydrogen phosphate |
| SMILES | CCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)(O)O |
| InChI | InChI=1S/C16H29O4P/c1-5-14(2)8-6-9-15(3)10-7-11-16(4)12-13-20-21(17,18)19/h8,10,12H,5-7,9,11,13H2,1-4H3,(H2,17,18,19) |
| InChIKey | VAIKPYQLAYLHTC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|