C53H87O4P — CID 101483911
[(2Z,5Z,9E,12Z,16Z,20Z,24Z,28E,32E,36E)-3,6,10,13,17,21,25,29,33,37,41-undecamethyldotetraconta-2,5,9,12,16,20,24,28,32,36,40-undecaenyl] dihydrogen phosphate (PubChem CID 101483911) has the molecular formula C53H87O4P and a molecular weight of 819.25 g/mol. Its IUPAC name is [(2Z,5Z,9E,12Z,16Z,20Z,24Z,28E,32E,36E)-3,6,10,13,17,21,25,29,33,37,41-undecamethyldotetraconta-2,5,9,12,16,20,24,28,32,36,40-undecaenyl] dihydrogen phosphate.
| Compound Name | [(2Z,5Z,9E,12Z,16Z,20Z,24Z,28E,32E,36E)-3,6,10,13,17,21,25,29,33,37,41-undecamethyldotetraconta-2,5,9,12,16,20,24,28,32,36,40-undecaenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 101483911 |
| Molecular Formula | C53H87O4P |
| Molecular Weight | 819.25 g/mol |
| Exact Mass | 818.63 |
| IUPAC Name | [(2Z,5Z,9E,12Z,16Z,20Z,24Z,28E,32E,36E)-3,6,10,13,17,21,25,29,33,37,41-undecamethyldotetraconta-2,5,9,12,16,20,24,28,32,36,40-undecaenyl] dihydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\C/C(C)=C/CC/C(C)=C\C/C(C)=C\COP(=O)(O)O |
| InChI | InChI=1S/C53H87O4P/c1-43(2)21-13-22-44(3)23-14-24-45(4)25-15-26-46(5)27-16-28-47(6)29-17-30-48(7)31-18-32-49(8)33-19-34-50(9)37-38-51(10)35-20-36-52(11)39-40-53(12)41-42-57-58(54,55)56/h21,23,25,27,29,31,33,35,37,39,41H,13-20,22,24,26,28,30,32,34,36,38,40,42H2,1-12H3,(H2,54,55,56)/b44-23+,45-25+,46-27+,47-29-,48-31-,49-33-,50-37-,51-35+,52-39-,53-41- |
| InChIKey | RCPANYSKLZZURT-PMUMCUJQSA-N |
| XLogP | 17.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.25 |
| LogP ≤ 5 | 17.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|