C25H43O4P — CID 101268225
[(2E,5E,8E)-3,9,13-trimethyl-6-(6-methylhept-5-en-2-yl)tetradeca-2,5,8,12-tetraenyl] dihydrogen phosphate (PubChem CID 101268225) has the molecular formula C25H43O4P and a molecular weight of 438.59 g/mol. Its IUPAC name is [(2E,5E,8E)-3,9,13-trimethyl-6-(6-methylhept-5-en-2-yl)tetradeca-2,5,8,12-tetraenyl] dihydrogen phosphate.
| Compound Name | [(2E,5E,8E)-3,9,13-trimethyl-6-(6-methylhept-5-en-2-yl)tetradeca-2,5,8,12-tetraenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 101268225 |
| Molecular Formula | C25H43O4P |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | [(2E,5E,8E)-3,9,13-trimethyl-6-(6-methylhept-5-en-2-yl)tetradeca-2,5,8,12-tetraenyl] dihydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C/C/C(=C\C/C(C)=C/COP(=O)(O)O)C(C)CCC=C(C)C |
| InChI | InChI=1S/C25H43O4P/c1-20(2)10-8-12-22(5)14-16-25(24(7)13-9-11-21(3)4)17-15-23(6)18-19-29-30(26,27)28/h10-11,14,17-18,24H,8-9,12-13,15-16,19H2,1-7H3,(H2,26,27,28)/b22-14+,23-18+,25-17+ |
| InChIKey | BDMAYASBLVNUHL-AIBIJAIKSA-N |
| XLogP | 7.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|