C40H70O13P4 — CID 174057821
[[(2E)-3,7-dimethylocta-2,6-dienoxy]-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phosphoryl] [hydroxy(phosphonooxy)phosphoryl] 3,7,11-trimethyldodeca-2,6,10-trienyl phosphate (PubChem CID 174057821) has the molecular formula C40H70O13P4 and a molecular weight of 882.88 g/mol. Its IUPAC name is [[(2E)-3,7-dimethylocta-2,6-dienoxy]-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phosphoryl] [hydroxy(phosphonooxy)phosphoryl] 3,7,11-trimethyldodeca-2,6,10-trienyl phosphate.
| Compound Name | [[(2E)-3,7-dimethylocta-2,6-dienoxy]-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phosphoryl] [hydroxy(phosphonooxy)phosphoryl] 3,7,11-trimethyldodeca-2,6,10-trienyl phosphate |
|---|---|
| PubChem CID | 174057821 |
| Molecular Formula | C40H70O13P4 |
| Molecular Weight | 882.88 g/mol |
| Exact Mass | 882.38 |
| IUPAC Name | [[(2E)-3,7-dimethylocta-2,6-dienoxy]-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phosphoryl] [hydroxy(phosphonooxy)phosphoryl] 3,7,11-trimethyldodeca-2,6,10-trienyl phosphate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOP(=O)(OC/C=C(\C)CCC=C(C)C)OP(=O)(OCC=C(C)CCC=C(C)CCC=C(C)C)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C40H70O13P4/c1-33(2)17-12-20-36(7)23-15-25-39(10)28-31-49-56(46,48-30-27-38(9)22-14-19-35(5)6)53-57(47,52-55(44,45)51-54(41,42)43)50-32-29-40(11)26-16-24-37(8)21-13-18-34(3)4/h17-19,23-24,27-29H,12-16,20-22,25-26,30-32H2,1-11H3,(H,44,45)(H2,41,42,43)/b36-23?,37-24?,38-27+,39-28?,40-29? |
| InChIKey | YDNUBVRDYSMNLI-XOGFCVTCSA-N |
| XLogP | 14.03 |
| TPSA | 184.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.88 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|