C25H48O6P2 — CID 139611461
(6E,10E)-14,14-bis(diethoxyphosphoryl)-2,6,10-trimethyltetradeca-2,6,10-triene (PubChem CID 139611461) has the molecular formula C25H48O6P2 and a molecular weight of 506.60 g/mol. Its IUPAC name is (6E,10E)-14,14-bis(diethoxyphosphoryl)-2,6,10-trimethyltetradeca-2,6,10-triene.
| Compound Name | (6E,10E)-14,14-bis(diethoxyphosphoryl)-2,6,10-trimethyltetradeca-2,6,10-triene |
|---|---|
| PubChem CID | 139611461 |
| Molecular Formula | C25H48O6P2 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (6E,10E)-14,14-bis(diethoxyphosphoryl)-2,6,10-trimethyltetradeca-2,6,10-triene |
| SMILES | CCOP(=O)(OCC)C(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C25H48O6P2/c1-9-28-32(26,29-10-2)25(33(27,30-11-3)31-12-4)21-15-20-24(8)19-14-18-23(7)17-13-16-22(5)6/h16,18,20,25H,9-15,17,19,21H2,1-8H3/b23-18+,24-20+ |
| InChIKey | CIAZYMFAJVOVLH-LWUFTARWSA-N |
| XLogP | 9.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|