C19H37O5P2+ — CID 10024415
[(5E)-1-diethoxyphosphoryl-6,10-dimethylundeca-5,9-dienyl]-ethoxy-oxophosphanium (PubChem CID 10024415) has the molecular formula C19H37O5P2+ and a molecular weight of 407.45 g/mol. Its IUPAC name is [(5E)-1-diethoxyphosphoryl-6,10-dimethylundeca-5,9-dienyl]-ethoxy-oxophosphanium.
| Compound Name | [(5E)-1-diethoxyphosphoryl-6,10-dimethylundeca-5,9-dienyl]-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 10024415 |
| Molecular Formula | C19H37O5P2+ |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [(5E)-1-diethoxyphosphoryl-6,10-dimethylundeca-5,9-dienyl]-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)C(CCC/C=C(\C)CCC=C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C19H37O5P2/c1-7-22-25(20)19(26(21,23-8-2)24-9-3)16-11-10-14-18(6)15-12-13-17(4)5/h13-14,19H,7-12,15-16H2,1-6H3/q+1/b18-14+ |
| InChIKey | CIDCFIQVKHEBRE-NBVRZTHBSA-N |
| XLogP | 7.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|