C28H49O10PS — CID 54018313
1-[bis(2-methylpropanoyloxymethoxy)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid (PubChem CID 54018313) has the molecular formula C28H49O10PS and a molecular weight of 608.73 g/mol. Its IUPAC name is 1-[bis(2-methylpropanoyloxymethoxy)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid.
| Compound Name | 1-[bis(2-methylpropanoyloxymethoxy)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 54018313 |
| Molecular Formula | C28H49O10PS |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | 1-[bis(2-methylpropanoyloxymethoxy)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCCC(P(=O)(OCOC(=O)C(C)C)OCOC(=O)C(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C28H49O10PS/c1-21(2)13-11-15-25(8)17-12-16-24(7)14-9-10-18-26(40(32,33)34)39(31,37-19-35-27(29)22(3)4)38-20-36-28(30)23(5)6/h13-14,17,22-23,26H,9-12,15-16,18-20H2,1-8H3,(H,32,33,34) |
| InChIKey | KXDSQNSTEQBQIE-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|