C19H36O5P2 — CID 10386617
[(5E,9E)-1-[hydroxy(methyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid (PubChem CID 10386617) has the molecular formula C19H36O5P2 and a molecular weight of 406.44 g/mol. Its IUPAC name is [(5E,9E)-1-[hydroxy(methyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid.
| Compound Name | [(5E,9E)-1-[hydroxy(methyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid |
|---|---|
| PubChem CID | 10386617 |
| Molecular Formula | C19H36O5P2 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [(5E,9E)-1-[hydroxy(methyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCC(P(C)(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C19H36O5P2/c1-16(2)10-8-12-18(4)14-9-13-17(3)11-6-7-15-19(25(5,20)21)26(22,23)24/h10-11,14,19H,6-9,12-13,15H2,1-5H3,(H,20,21)(H2,22,23,24)/b17-11+,18-14+ |
| InChIKey | IQXGZGUZEQQEHJ-CBXDKUCNSA-N |
| XLogP | 5.98 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|