C17H33O8P3 — CID 10484367
[(3E,7E)-1-[hydroxy(phosphonomethyl)phosphoryl]-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphonic acid (PubChem CID 10484367) has the molecular formula C17H33O8P3 and a molecular weight of 458.37 g/mol. Its IUPAC name is [(3E,7E)-1-[hydroxy(phosphonomethyl)phosphoryl]-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphonic acid.
| Compound Name | [(3E,7E)-1-[hydroxy(phosphonomethyl)phosphoryl]-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphonic acid |
|---|---|
| PubChem CID | 10484367 |
| Molecular Formula | C17H33O8P3 |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [(3E,7E)-1-[hydroxy(phosphonomethyl)phosphoryl]-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC(P(=O)(O)O)P(=O)(O)CP(=O)(O)O |
| InChI | InChI=1S/C17H33O8P3/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-17(28(23,24)25)26(18,19)13-27(20,21)22/h7,9,11,17H,5-6,8,10,12-13H2,1-4H3,(H,18,19)(H2,20,21,22)(H2,23,24,25)/b15-9+,16-11+ |
| InChIKey | HXJDZXIXQILRMM-XGGJEREUSA-N |
| XLogP | 4.71 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|