C18H31O5P — CID 54543904
5,9,13-trimethyl-2-(phosphonomethyl)tetradeca-4,8,12-trienoic acid (PubChem CID 54543904) has the molecular formula C18H31O5P and a molecular weight of 358.42 g/mol. Its IUPAC name is 5,9,13-trimethyl-2-(phosphonomethyl)tetradeca-4,8,12-trienoic acid.
| Compound Name | 5,9,13-trimethyl-2-(phosphonomethyl)tetradeca-4,8,12-trienoic acid |
|---|---|
| PubChem CID | 54543904 |
| Molecular Formula | C18H31O5P |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 5,9,13-trimethyl-2-(phosphonomethyl)tetradeca-4,8,12-trienoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC(CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C18H31O5P/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-17(18(19)20)13-24(21,22)23/h7,9,11,17H,5-6,8,10,12-13H2,1-4H3,(H,19,20)(H2,21,22,23) |
| InChIKey | ZFEVGIIKNZJTPJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|