C19H31O5P — CID 19382818
(4E,6E,10E)-7,11,15-trimethyl-2-phosphonohexadeca-4,6,10,14-tetraenoic acid (PubChem CID 19382818) has the molecular formula C19H31O5P and a molecular weight of 370.43 g/mol. Its IUPAC name is (4E,6E,10E)-7,11,15-trimethyl-2-phosphonohexadeca-4,6,10,14-tetraenoic acid.
| Compound Name | (4E,6E,10E)-7,11,15-trimethyl-2-phosphonohexadeca-4,6,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 19382818 |
| Molecular Formula | C19H31O5P |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (4E,6E,10E)-7,11,15-trimethyl-2-phosphonohexadeca-4,6,10,14-tetraenoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/CC(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C19H31O5P/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18(19(20)21)25(22,23)24/h5-6,9-10,13,18H,7-8,11-12,14H2,1-4H3,(H,20,21)(H2,22,23,24)/b6-5+,16-10+,17-13+ |
| InChIKey | LFONYKLFQCLQFV-LVTXVWDSSA-N |
| XLogP | 4.98 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|