6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid

C18H28O2 — CID 88635558

IUPAC6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid
SMILESCC(C)=CCCC(C)=CCCC(C)=CC=CCC(=O)O
InChIInChI=1S/C18H28O2/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18(19)20/h5-6,9-10,13H,7-8,11-12,14H2,1-4H3,(H,19,20)
InChIKeyAOGCJNKODVEQDF-UHFFFAOYSA-N
MW276.42 g/mol
LogP5.44
Rot. Bonds9

About 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid

6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid (PubChem CID 88635558) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid.

Molecular Properties

Compound Name6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid
PubChem CID88635558
Molecular FormulaC18H28O2
Molecular Weight276.42 g/mol
Exact Mass276.21
IUPAC Name6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid
SMILESCC(C)=CCCC(C)=CCCC(C)=CC=CCC(=O)O
InChIInChI=1S/C18H28O2/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18(19)20/h5-6,9-10,13H,7-8,11-12,14H2,1-4H3,(H,19,20)
InChIKeyAOGCJNKODVEQDF-UHFFFAOYSA-N
XLogP5.44
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds9
Heavy Atoms20
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500276.42
LogP ≤ 55.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid?
The IUPAC name of 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid (CID 88635558) is 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid.
What is the SMILES notation for 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid?
The canonical SMILES for 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid is CC(C)=CCCC(C)=CCCC(C)=CC=CCC(=O)O.
What is the InChIKey of 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid?
The InChIKey is AOGCJNKODVEQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18(19)20/h5-6,9-10,13H,7-8,11-12,14H2,1-4H3,(H,19,20).
What are the key properties of 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid?
6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid has a molecular weight of 276.42 g/mol, XLogP of 5.44, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid is sourced from PubChem (CID 88635558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).