C18H28O2 — CID 88635558
6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid (PubChem CID 88635558) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid.
| Compound Name | 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid |
|---|---|
| PubChem CID | 88635558 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 6,10,14-trimethylpentadeca-3,5,9,13-tetraenoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC=CCC(=O)O |
| InChI | InChI=1S/C18H28O2/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18(19)20/h5-6,9-10,13H,7-8,11-12,14H2,1-4H3,(H,19,20) |
| InChIKey | AOGCJNKODVEQDF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|