C19H30O — CID 168749339
(2Z,4E,6E,10E)-7,11,15-trimethylhexadeca-2,4,6,10,14-pentaen-1-ol (PubChem CID 168749339) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (2Z,4E,6E,10E)-7,11,15-trimethylhexadeca-2,4,6,10,14-pentaen-1-ol.
| Compound Name | (2Z,4E,6E,10E)-7,11,15-trimethylhexadeca-2,4,6,10,14-pentaen-1-ol |
|---|---|
| PubChem CID | 168749339 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (2Z,4E,6E,10E)-7,11,15-trimethylhexadeca-2,4,6,10,14-pentaen-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C=C\CO |
| InChI | InChI=1S/C19H30O/c1-17(2)11-9-13-19(4)15-10-14-18(3)12-7-5-6-8-16-20/h5-8,11-12,15,20H,9-10,13-14,16H2,1-4H3/b7-5+,8-6-,18-12+,19-15+ |
| InChIKey | BPEJPZFCWKFGQK-FBXXUMKSSA-N |
| XLogP | 5.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|