C20H35O5P — CID 22404035
(6E,10E)-7,11,15-trimethyl-2-(phosphonomethyl)hexadeca-6,10,14-trienoic acid (PubChem CID 22404035) has the molecular formula C20H35O5P and a molecular weight of 386.47 g/mol. Its IUPAC name is (6E,10E)-7,11,15-trimethyl-2-(phosphonomethyl)hexadeca-6,10,14-trienoic acid.
| Compound Name | (6E,10E)-7,11,15-trimethyl-2-(phosphonomethyl)hexadeca-6,10,14-trienoic acid |
|---|---|
| PubChem CID | 22404035 |
| Molecular Formula | C20H35O5P |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (6E,10E)-7,11,15-trimethyl-2-(phosphonomethyl)hexadeca-6,10,14-trienoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCC(CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C20H35O5P/c1-16(2)9-7-11-18(4)13-8-12-17(3)10-5-6-14-19(20(21)22)15-26(23,24)25/h9-10,13,19H,5-8,11-12,14-15H2,1-4H3,(H,21,22)(H2,23,24,25)/b17-10+,18-13+ |
| InChIKey | YGSWRJHZTFKLOT-YAUBYZHOSA-N |
| XLogP | 5.45 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|