C14H27O6P2+ — CID 57322273
(6,10-dimethyl-1-phosphonoundeca-5,9-dienyl)-formyl-dihydroxyphosphanium (PubChem CID 57322273) has the molecular formula C14H27O6P2+ and a molecular weight of 353.31 g/mol. Its IUPAC name is (6,10-dimethyl-1-phosphonoundeca-5,9-dienyl)-formyl-dihydroxyphosphanium.
| Compound Name | (6,10-dimethyl-1-phosphonoundeca-5,9-dienyl)-formyl-dihydroxyphosphanium |
|---|---|
| PubChem CID | 57322273 |
| Molecular Formula | C14H27O6P2+ |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (6,10-dimethyl-1-phosphonoundeca-5,9-dienyl)-formyl-dihydroxyphosphanium |
| SMILES | CC(C)=CCCC(C)=CCCCC(P(=O)(O)O)[P+](O)(O)C=O |
| InChI | InChI=1S/C14H26O6P2/c1-12(2)7-6-9-13(3)8-4-5-10-14(22(18,19)20)21(16,17)11-15/h7-8,11,14,16-17H,4-6,9-10H2,1-3H3,(H-,18,19,20)/p+1 |
| InChIKey | PWHIPLDCPUDGSS-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|