C14H26O5P2+2 — CID 57121402
[1-[formyl(oxo)phosphaniumyl]-6,10-dimethylundeca-5,9-dienyl]-trihydroxyphosphanium (PubChem CID 57121402) has the molecular formula C14H26O5P2+2 and a molecular weight of 336.31 g/mol. Its IUPAC name is [1-[formyl(oxo)phosphaniumyl]-6,10-dimethylundeca-5,9-dienyl]-trihydroxyphosphanium.
| Compound Name | [1-[formyl(oxo)phosphaniumyl]-6,10-dimethylundeca-5,9-dienyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 57121402 |
| Molecular Formula | C14H26O5P2+2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [1-[formyl(oxo)phosphaniumyl]-6,10-dimethylundeca-5,9-dienyl]-trihydroxyphosphanium |
| SMILES | CC(C)=CCCC(C)=CCCCC([P+](=O)C=O)[P+](O)(O)O |
| InChI | InChI=1S/C14H26O5P2/c1-12(2)7-6-9-13(3)8-4-5-10-14(20(16)11-15)21(17,18)19/h7-8,11,14,17-19H,4-6,9-10H2,1-3H3/q+2 |
| InChIKey | IVDPNAZAGLFWQZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|