C27H46O5 — CID 154445294
3-hydroxy-2,2-bis(hydroxymethyl)-8,12,16,20-tetramethylhenicosa-7,11,15,19-tetraenoic acid (PubChem CID 154445294) has the molecular formula C27H46O5 and a molecular weight of 450.66 g/mol. Its IUPAC name is 3-hydroxy-2,2-bis(hydroxymethyl)-8,12,16,20-tetramethylhenicosa-7,11,15,19-tetraenoic acid.
| Compound Name | 3-hydroxy-2,2-bis(hydroxymethyl)-8,12,16,20-tetramethylhenicosa-7,11,15,19-tetraenoic acid |
|---|---|
| PubChem CID | 154445294 |
| Molecular Formula | C27H46O5 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | 3-hydroxy-2,2-bis(hydroxymethyl)-8,12,16,20-tetramethylhenicosa-7,11,15,19-tetraenoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCCC(O)C(CO)(CO)C(=O)O |
| InChI | InChI=1S/C27H46O5/c1-21(2)11-8-13-23(4)15-10-17-24(5)16-9-14-22(3)12-6-7-18-25(30)27(19-28,20-29)26(31)32/h11-12,15-16,25,28-30H,6-10,13-14,17-20H2,1-5H3,(H,31,32) |
| InChIKey | HJNRNNBALAWIQA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|