C21H38O — CID 126609123
(6E,10E)-2,2,7,11,15-pentamethylhexadeca-6,10,14-trien-3-ol (PubChem CID 126609123) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is (6E,10E)-2,2,7,11,15-pentamethylhexadeca-6,10,14-trien-3-ol.
| Compound Name | (6E,10E)-2,2,7,11,15-pentamethylhexadeca-6,10,14-trien-3-ol |
|---|---|
| PubChem CID | 126609123 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | (6E,10E)-2,2,7,11,15-pentamethylhexadeca-6,10,14-trien-3-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(O)C(C)(C)C |
| InChI | InChI=1S/C21H38O/c1-17(2)11-8-12-18(3)13-9-14-19(4)15-10-16-20(22)21(5,6)7/h11,13,15,20,22H,8-10,12,14,16H2,1-7H3/b18-13+,19-15+ |
| InChIKey | SFKBYINHXHZPDD-HQSZAHFGSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|