C45H86O8 — CID 124825354
(2E,6E,10S,11S,15S,19S,23R,27R,31R)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,34-triene-1,10,11,15,19,23,27,31-octol (PubChem CID 124825354) has the molecular formula C45H86O8 and a molecular weight of 755.17 g/mol. Its IUPAC name is (2E,6E,10S,11S,15S,19S,23R,27R,31R)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,34-triene-1,10,11,15,19,23,27,31-octol.
| Compound Name | (2E,6E,10S,11S,15S,19S,23R,27R,31R)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,34-triene-1,10,11,15,19,23,27,31-octol |
|---|---|
| PubChem CID | 124825354 |
| Molecular Formula | C45H86O8 |
| Molecular Weight | 755.17 g/mol |
| Exact Mass | 754.63 |
| IUPAC Name | (2E,6E,10S,11S,15S,19S,23R,27R,31R)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,34-triene-1,10,11,15,19,23,27,31-octol |
| SMILES | CC(C)=CCC[C@](C)(O)CCC[C@](C)(O)CCC[C@](C)(O)CCC[C@](C)(O)CCC[C@](C)(O)CCC[C@](C)(O)[C@@H](O)CC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C45H86O8/c1-36(2)18-12-24-40(5,48)25-13-26-41(6,49)27-14-28-42(7,50)29-15-30-43(8,51)31-16-32-44(9,52)33-17-34-45(10,53)39(47)22-21-37(3)19-11-20-38(4)23-35-46/h18-19,23,39,46-53H,11-17,20-22,24-35H2,1-10H3/b37-19+,38-23+/t39-,40-,41-,42-,43-,44-,45-/m0/s1 |
| InChIKey | MFQDKOXWQXOOAO-BESBOIIPSA-N |
| XLogP | 8.90 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.17 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|