C32H58O7 — CID 162904726
[(3S,6S,7R,10R,11S,14E,18E)-2,3,6,10,11-pentahydroxy-2,6,10,15,19,23-hexamethyltetracosa-14,18,22-trien-7-yl] acetate (PubChem CID 162904726) has the molecular formula C32H58O7 and a molecular weight of 554.81 g/mol. Its IUPAC name is [(3S,6S,7R,10R,11S,14E,18E)-2,3,6,10,11-pentahydroxy-2,6,10,15,19,23-hexamethyltetracosa-14,18,22-trien-7-yl] acetate.
| Compound Name | [(3S,6S,7R,10R,11S,14E,18E)-2,3,6,10,11-pentahydroxy-2,6,10,15,19,23-hexamethyltetracosa-14,18,22-trien-7-yl] acetate |
|---|---|
| PubChem CID | 162904726 |
| Molecular Formula | C32H58O7 |
| Molecular Weight | 554.81 g/mol |
| Exact Mass | 554.42 |
| IUPAC Name | [(3S,6S,7R,10R,11S,14E,18E)-2,3,6,10,11-pentahydroxy-2,6,10,15,19,23-hexamethyltetracosa-14,18,22-trien-7-yl] acetate |
| SMILES | CC(=O)O[C@H](CC[C@@](C)(O)[C@@H](O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@@](C)(O)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C32H58O7/c1-23(2)13-10-14-24(3)15-11-16-25(4)17-12-18-28(35)31(8,37)22-20-29(39-26(5)33)32(9,38)21-19-27(34)30(6,7)36/h13,15,17,27-29,34-38H,10-12,14,16,18-22H2,1-9H3/b24-15+,25-17+/t27-,28-,29+,31+,32-/m0/s1 |
| InChIKey | KDISVRQLNWRFRQ-LEKQNCSXSA-N |
| XLogP | 5.67 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.81 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|