C34H58O7 — CID 74319234
(3-acetyloxy-2,22,23-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraenyl) acetate (PubChem CID 74319234) has the molecular formula C34H58O7 and a molecular weight of 578.83 g/mol. Its IUPAC name is (3-acetyloxy-2,22,23-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraenyl) acetate.
| Compound Name | (3-acetyloxy-2,22,23-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraenyl) acetate |
|---|---|
| PubChem CID | 74319234 |
| Molecular Formula | C34H58O7 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | (3-acetyloxy-2,22,23-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraenyl) acetate |
| SMILES | CC(=O)OCC(C)(O)C(CCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC(O)C(C)(C)O)OC(C)=O |
| InChI | InChI=1S/C34H58O7/c1-25(16-12-18-27(3)20-22-31(37)33(7,8)38)14-10-11-15-26(2)17-13-19-28(4)21-23-32(41-30(6)36)34(9,39)24-40-29(5)35/h14-15,18-19,31-32,37-39H,10-13,16-17,20-24H2,1-9H3 |
| InChIKey | WVMDVHDOEYMXEG-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|