C25H36O6 — CID 71574037
[(10E)-14-(2,4-dihydroxyphenyl)-6-hydroxy-2,6,10-trimethyl-14-oxotetradeca-2,10-dien-7-yl] acetate (PubChem CID 71574037) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(10E)-14-(2,4-dihydroxyphenyl)-6-hydroxy-2,6,10-trimethyl-14-oxotetradeca-2,10-dien-7-yl] acetate.
| Compound Name | [(10E)-14-(2,4-dihydroxyphenyl)-6-hydroxy-2,6,10-trimethyl-14-oxotetradeca-2,10-dien-7-yl] acetate |
|---|---|
| PubChem CID | 71574037 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [(10E)-14-(2,4-dihydroxyphenyl)-6-hydroxy-2,6,10-trimethyl-14-oxotetradeca-2,10-dien-7-yl] acetate |
| SMILES | CC(=O)OC(CC/C(C)=C/CCC(=O)c1ccc(O)cc1O)C(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C25H36O6/c1-17(2)8-7-15-25(5,30)24(31-19(4)26)14-11-18(3)9-6-10-22(28)21-13-12-20(27)16-23(21)29/h8-9,12-13,16,24,27,29-30H,6-7,10-11,14-15H2,1-5H3/b18-9+ |
| InChIKey | JDVWBXDBNKCEEE-GIJQJNRQSA-N |
| XLogP | 5.22 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|