C18H24O5 — CID 24761036
1-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4,6-dihydroxyphenyl]-2-hydroxyethanone (PubChem CID 24761036) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4,6-dihydroxyphenyl]-2-hydroxyethanone.
| Compound Name | 1-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4,6-dihydroxyphenyl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 24761036 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4,6-dihydroxyphenyl]-2-hydroxyethanone |
| SMILES | CC(C)=CCC/C(C)=C/COc1cc(O)cc(O)c1C(=O)CO |
| InChI | InChI=1S/C18H24O5/c1-12(2)5-4-6-13(3)7-8-23-17-10-14(20)9-15(21)18(17)16(22)11-19/h5,7,9-10,19-21H,4,6,8,11H2,1-3H3/b13-7+ |
| InChIKey | WZBHGSCBQIAXHJ-NTUHNPAUSA-N |
| XLogP | 3.34 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|