C23H32O3 — CID 71574038
(4E,7E)-1-(2,4-dihydroxyphenyl)-3,4,8,12-tetramethyltrideca-4,7,11-trien-1-one (PubChem CID 71574038) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (4E,7E)-1-(2,4-dihydroxyphenyl)-3,4,8,12-tetramethyltrideca-4,7,11-trien-1-one.
| Compound Name | (4E,7E)-1-(2,4-dihydroxyphenyl)-3,4,8,12-tetramethyltrideca-4,7,11-trien-1-one |
|---|---|
| PubChem CID | 71574038 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (4E,7E)-1-(2,4-dihydroxyphenyl)-3,4,8,12-tetramethyltrideca-4,7,11-trien-1-one |
| SMILES | CC(C)=CCC/C(C)=C/C/C=C(\C)C(C)CC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C23H32O3/c1-16(2)8-6-9-17(3)10-7-11-18(4)19(5)14-22(25)21-13-12-20(24)15-23(21)26/h8,10-13,15,19,24,26H,6-7,9,14H2,1-5H3/b17-10+,18-11+ |
| InChIKey | HFXVGVAUUXMKQO-ODPUSEOTSA-N |
| XLogP | 6.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|