About (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one
(3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one (PubChem CID 143932136) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one.
Molecular Properties
| Compound Name | (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one |
| PubChem CID | 143932136 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one |
| SMILES | C=C/C=C(\C)CC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H14O3/c1-3-4-9(2)7-12(15)11-6-5-10(14)8-13(11)16/h3-6,8,14,16H,1,7H2,2H3/b9-4+ |
| InChIKey | KBQFOBWEIOTJKI-RUDMXATFSA-N |
| XLogP | 2.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one?
The IUPAC name of (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one (CID 143932136) is (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one.
What is the SMILES notation for (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one?
The canonical SMILES for (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one is C=C/C=C(\C)CC(=O)c1ccc(O)cc1O.
What is the InChIKey of (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one?
The InChIKey is KBQFOBWEIOTJKI-RUDMXATFSA-N. The full InChI is InChI=1S/C13H14O3/c1-3-4-9(2)7-12(15)11-6-5-10(14)8-13(11)16/h3-6,8,14,16H,1,7H2,2H3/b9-4+.
What are the key properties of (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one?
(3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one has a molecular weight of 218.25 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-(2,4-dihydroxyphenyl)-3-methylhexa-3,5-dien-1-one is sourced from PubChem (CID 143932136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).