C14H14O2 — CID 144763250
(3Z)-3-ethenyl-1-(2-hydroxyphenyl)hexa-3,5-dien-1-one (PubChem CID 144763250) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3Z)-3-ethenyl-1-(2-hydroxyphenyl)hexa-3,5-dien-1-one.
| Compound Name | (3Z)-3-ethenyl-1-(2-hydroxyphenyl)hexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 144763250 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (3Z)-3-ethenyl-1-(2-hydroxyphenyl)hexa-3,5-dien-1-one |
| SMILES | C=C/C=C(\C=C)CC(=O)c1ccccc1O |
| InChI | InChI=1S/C14H14O2/c1-3-7-11(4-2)10-14(16)12-8-5-6-9-13(12)15/h3-9,15H,1-2,10H2/b11-7+ |
| InChIKey | BEKWXFNNPWYAEN-YRNVUSSQSA-N |
| XLogP | 3.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|