About (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide
(3Z)-3-ethenyl-N-oxohexa-3,5-dienamide (PubChem CID 89001510) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide.
Molecular Properties
| Compound Name | (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide |
| PubChem CID | 89001510 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide |
| SMILES | C=C/C=C(\C=C)CC(=O)N=O |
| InChI | InChI=1S/C8H9NO2/c1-3-5-7(4-2)6-8(10)9-11/h3-5H,1-2,6H2/b7-5+ |
| InChIKey | IQYLYKSWGXTRCE-FNORWQNLSA-N |
| XLogP | 1.97 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide?
The IUPAC name of (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide (CID 89001510) is (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide.
What is the SMILES notation for (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide?
The canonical SMILES for (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide is C=C/C=C(\C=C)CC(=O)N=O.
What is the InChIKey of (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide?
The InChIKey is IQYLYKSWGXTRCE-FNORWQNLSA-N. The full InChI is InChI=1S/C8H9NO2/c1-3-5-7(4-2)6-8(10)9-11/h3-5H,1-2,6H2/b7-5+.
What are the key properties of (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide?
(3Z)-3-ethenyl-N-oxohexa-3,5-dienamide has a molecular weight of 151.16 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-ethenyl-N-oxohexa-3,5-dienamide is sourced from PubChem (CID 89001510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).