C10H17NO — CID 143006742
(3Z)-3-ethenylhexa-3,5-dienal;N-methylmethanamine (PubChem CID 143006742) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (3Z)-3-ethenylhexa-3,5-dienal;N-methylmethanamine.
| Compound Name | (3Z)-3-ethenylhexa-3,5-dienal;N-methylmethanamine |
|---|---|
| PubChem CID | 143006742 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3Z)-3-ethenylhexa-3,5-dienal;N-methylmethanamine |
| SMILES | C=C/C=C(\C=C)CC=O.CNC |
| InChI | InChI=1S/C8H10O.C2H7N/c1-3-5-8(4-2)6-7-9;1-3-2/h3-5,7H,1-2,6H2;3H,1-2H3/b8-5+; |
| InChIKey | NXRYQXZGTHEEGT-HAAWTFQLSA-N |
| XLogP | 1.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|