C11H17NO — CID 142384554
(3Z)-3-[(E)-1-(methylamino)but-2-en-2-yl]hexa-3,5-dienal (PubChem CID 142384554) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (3Z)-3-[(E)-1-(methylamino)but-2-en-2-yl]hexa-3,5-dienal.
| Compound Name | (3Z)-3-[(E)-1-(methylamino)but-2-en-2-yl]hexa-3,5-dienal |
|---|---|
| PubChem CID | 142384554 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3Z)-3-[(E)-1-(methylamino)but-2-en-2-yl]hexa-3,5-dienal |
| SMILES | C=C/C=C(CC=O)\C(=C/C)CNC |
| InChI | InChI=1S/C11H17NO/c1-4-6-11(7-8-13)10(5-2)9-12-3/h4-6,8,12H,1,7,9H2,2-3H3/b10-5-,11-6- |
| InChIKey | IPDCPXKZQCFVMT-IEESQIRDSA-N |
| XLogP | 1.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|