C14H26 — CID 143333904
ethane;(3Z,5Z)-5-ethyl-4-propylhepta-1,3,5-triene (PubChem CID 143333904) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is ethane;(3Z,5Z)-5-ethyl-4-propylhepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-5-ethyl-4-propylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143333904 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | ethane;(3Z,5Z)-5-ethyl-4-propylhepta-1,3,5-triene |
| SMILES | C=C/C=C(CCC)\C(=C/C)CC.CC |
| InChI | InChI=1S/C12H20.C2H6/c1-5-9-12(10-6-2)11(7-3)8-4;1-2/h5,7,9H,1,6,8,10H2,2-4H3;1-2H3/b11-7-,12-9-; |
| InChIKey | PKRAPOKCNDGTLW-SLNVHFLZSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|