C14H29N — CID 156719624
ethane;(2E,4Z)-4-ethyl-N-methylhepta-2,4,6-trien-3-amine (PubChem CID 156719624) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is ethane;(2E,4Z)-4-ethyl-N-methylhepta-2,4,6-trien-3-amine.
| Compound Name | ethane;(2E,4Z)-4-ethyl-N-methylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 156719624 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | ethane;(2E,4Z)-4-ethyl-N-methylhepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(CC)\C(=C/C)NC.CC.CC |
| InChI | InChI=1S/C10H17N.2C2H6/c1-5-8-9(6-2)10(7-3)11-4;2*1-2/h5,7-8,11H,1,6H2,2-4H3;2*1-2H3/b9-8-,10-7+;; |
| InChIKey | GLSHABRPAYAYJH-YGTZMAEMSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|